C25H30BrNO4 — CID 10254920
(1R,2R,7S,9S)-4,12-diphenylspiro[3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane-8,1'-azinan-1-ium] bromide (PubChem CID 10254920) has the molecular formula C25H30BrNO4 and a molecular weight of 488.42 g/mol. Its IUPAC name is (1R,2R,7S,9S)-4,12-diphenylspiro[3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane-8,1'-azinan-1-ium] bromide.
| Compound Name | (1R,2R,7S,9S)-4,12-diphenylspiro[3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane-8,1'-azinan-1-ium] bromide |
|---|---|
| PubChem CID | 10254920 |
| Molecular Formula | C25H30BrNO4 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (1R,2R,7S,9S)-4,12-diphenylspiro[3,5,11,13-tetraoxa-8-azoniatricyclo[7.4.0.02,7]tridecane-8,1'-azinan-1-ium] bromide |
| SMILES | [Br-].c1ccc(C2OC[C@H]3[C@@H](O2)[C@@H]2OC(c4ccccc4)OC[C@@H]2[N+]32CCCCC2)cc1 |
| InChI | InChI=1S/C25H30NO4.BrH/c1-4-10-18(11-5-1)24-27-16-20-22(29-24)23-21(26(20)14-8-3-9-15-26)17-28-25(30-23)19-12-6-2-7-13-19;/h1-2,4-7,10-13,20-25H,3,8-9,14-17H2;1H/q+1;/p-1/t20-,21-,22+,23+,24?,25?;/m0./s1 |
| InChIKey | BMFIMSZKJNNGKO-QIFCNHLDSA-M |
| XLogP | 0.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|