C19H24N2O4S — CID 102561014
3-(2,5-dimethylpyrrol-1-yl)-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methoxybenzamide (PubChem CID 102561014) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methoxybenzamide.
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 102561014 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC2CCCS2(=O)=O)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C19H24N2O4S/c1-13-6-7-14(2)21(13)17-11-15(8-9-18(17)25-3)19(22)20-12-16-5-4-10-26(16,23)24/h6-9,11,16H,4-5,10,12H2,1-3H3,(H,20,22) |
| InChIKey | ZHIMWZUKBNYHLC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|