C17H22F3N3O2 — CID 102561770
2-methyl-N'-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxypropanimidamide (PubChem CID 102561770) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-methyl-N'-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxypropanimidamide.
| Compound Name | 2-methyl-N'-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxypropanimidamide |
|---|---|
| PubChem CID | 102561770 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-methyl-N'-[2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxypropanimidamide |
| SMILES | CC(C)/C(N)=N/OC1CCCN(Cc2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C17H22F3N3O2/c1-11(2)15(21)22-25-14-7-4-8-23(16(14)24)10-12-5-3-6-13(9-12)17(18,19)20/h3,5-6,9,11,14H,4,7-8,10H2,1-2H3,(H2,21,22) |
| InChIKey | QFTKQDMLVLFMOZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|