C31H35NO9S — CID 10257966
[3-(nitrooxymethyl)phenyl] 7-acetylsulfanyl-13-methyl-2',3-dioxospiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate (PubChem CID 10257966) has the molecular formula C31H35NO9S and a molecular weight of 597.69 g/mol. Its IUPAC name is [3-(nitrooxymethyl)phenyl] 7-acetylsulfanyl-13-methyl-2',3-dioxospiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate.
| Compound Name | [3-(nitrooxymethyl)phenyl] 7-acetylsulfanyl-13-methyl-2',3-dioxospiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate |
|---|---|
| PubChem CID | 10257966 |
| Molecular Formula | C31H35NO9S |
| Molecular Weight | 597.69 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | [3-(nitrooxymethyl)phenyl] 7-acetylsulfanyl-13-methyl-2',3-dioxospiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-3'-carboxylate |
| SMILES | CC(=O)SC1CC2=CC(=O)CCC2C2CCC3(C)C(CCC34CC(C(=O)Oc3cccc(CO[N+](=O)[O-])c3)C(=O)O4)C12 |
| InChI | InChI=1S/C31H35NO9S/c1-17(33)42-26-14-19-13-20(34)6-7-22(19)23-8-10-30(2)25(27(23)26)9-11-31(30)15-24(29(36)41-31)28(35)40-21-5-3-4-18(12-21)16-39-32(37)38/h3-5,12-13,22-27H,6-11,14-16H2,1-2H3 |
| InChIKey | YJNDBZNDXOVMIW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 139.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|