C15H21NO12S2-2 — CID 102589337
[(2S,3R,4R,5R,6R)-2-(2-hydroxyethoxy)-6-(hydroxymethyl)-5-phenylmethoxy-3-(sulfonatoamino)oxan-4-yl] sulfate (PubChem CID 102589337) has the molecular formula C15H21NO12S2-2 and a molecular weight of 471.46 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-2-(2-hydroxyethoxy)-6-(hydroxymethyl)-5-phenylmethoxy-3-(sulfonatoamino)oxan-4-yl] sulfate.
| Compound Name | [(2S,3R,4R,5R,6R)-2-(2-hydroxyethoxy)-6-(hydroxymethyl)-5-phenylmethoxy-3-(sulfonatoamino)oxan-4-yl] sulfate |
|---|---|
| PubChem CID | 102589337 |
| Molecular Formula | C15H21NO12S2-2 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-2-(2-hydroxyethoxy)-6-(hydroxymethyl)-5-phenylmethoxy-3-(sulfonatoamino)oxan-4-yl] sulfate |
| SMILES | O=S(=O)([O-])N[C@H]1[C@@H](OCCO)O[C@H](CO)[C@@H](OCc2ccccc2)[C@@H]1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H23NO12S2/c17-6-7-25-15-12(16-29(19,20)21)14(28-30(22,23)24)13(11(8-18)27-15)26-9-10-4-2-1-3-5-10/h1-5,11-18H,6-9H2,(H,19,20,21)(H,22,23,24)/p-2/t11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | DTDSGIXWHUYEHL-RYPNDVFKSA-L |
| XLogP | -2.44 |
| TPSA | 203.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|