C19H22Cl2N2O7S2 — CID 102596232
11,25-dichloro-15,18,21-trioxa-2λ6,8λ6-dithia-3,7-diazatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene 2,2,8,8-tetraoxide (PubChem CID 102596232) has the molecular formula C19H22Cl2N2O7S2 and a molecular weight of 525.43 g/mol. Its IUPAC name is 11,25-dichloro-15,18,21-trioxa-2λ6,8λ6-dithia-3,7-diazatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene 2,2,8,8-tetraoxide.
| Compound Name | 11,25-dichloro-15,18,21-trioxa-2λ6,8λ6-dithia-3,7-diazatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene 2,2,8,8-tetraoxide |
|---|---|
| PubChem CID | 102596232 |
| Molecular Formula | C19H22Cl2N2O7S2 |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | 11,25-dichloro-15,18,21-trioxa-2λ6,8λ6-dithia-3,7-diazatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene 2,2,8,8-tetraoxide |
| SMILES | O=S1(=O)NCCCNS(=O)(=O)c2cc(Cl)ccc2OCCOCCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H22Cl2N2O7S2/c20-14-2-4-16-18(12-14)31(24,25)22-6-1-7-23-32(26,27)19-13-15(21)3-5-17(19)30-11-9-28-8-10-29-16/h2-5,12-13,22-23H,1,6-11H2 |
| InChIKey | IQUVNVCGVZARAT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |