C8H14N4O2S — CID 102690322
1-(1H-pyrazol-5-ylsulfonyl)piperidin-4-amine (PubChem CID 102690322) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-ylsulfonyl)piperidin-4-amine.
| Compound Name | 1-(1H-pyrazol-5-ylsulfonyl)piperidin-4-amine |
|---|---|
| PubChem CID | 102690322 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-(1H-pyrazol-5-ylsulfonyl)piperidin-4-amine |
| SMILES | NC1CCN(S(=O)(=O)c2ccn[nH]2)CC1 |
| InChI | InChI=1S/C8H14N4O2S/c9-7-2-5-12(6-3-7)15(13,14)8-1-4-10-11-8/h1,4,7H,2-3,5-6,9H2,(H,10,11) |
| InChIKey | KCAUSWQUYMPXBH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |