C17H30N6O2 — CID 10269345
3-[(5R)-5-(dimethylamino)hexyl]-1-methyl-4a,6,7,8,10,10a-hexahydropurino[7,8-a]pyrimidine-2,4-dione (PubChem CID 10269345) has the molecular formula C17H30N6O2 and a molecular weight of 350.47 g/mol. Its IUPAC name is 3-[(5R)-5-(dimethylamino)hexyl]-1-methyl-4a,6,7,8,10,10a-hexahydropurino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 3-[(5R)-5-(dimethylamino)hexyl]-1-methyl-4a,6,7,8,10,10a-hexahydropurino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10269345 |
| Molecular Formula | C17H30N6O2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 3-[(5R)-5-(dimethylamino)hexyl]-1-methyl-4a,6,7,8,10,10a-hexahydropurino[7,8-a]pyrimidine-2,4-dione |
| SMILES | C[C@H](CCCCN1C(=O)C2C(NC3=NCCCN32)N(C)C1=O)N(C)C |
| InChI | InChI=1S/C17H30N6O2/c1-12(20(2)3)8-5-6-10-23-15(24)13-14(21(4)17(23)25)19-16-18-9-7-11-22(13)16/h12-14H,5-11H2,1-4H3,(H,18,19)/t12-,13?,14?/m1/s1 |
| InChIKey | VPCZQCKMNLWBOQ-IYXRBSQSSA-N |
| XLogP | 0.36 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|