C37H63N5O5 — CID 10290212
3-(diaminomethylidene)-1,1-dimethylguanidine;(Z)-4-oxo-4-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxy]but-2-enoic acid (PubChem CID 10290212) has the molecular formula C37H63N5O5 and a molecular weight of 657.94 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,1-dimethylguanidine;(Z)-4-oxo-4-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxy]but-2-enoic acid.
| Compound Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;(Z)-4-oxo-4-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxy]but-2-enoic acid |
|---|---|
| PubChem CID | 10290212 |
| Molecular Formula | C37H63N5O5 |
| Molecular Weight | 657.94 g/mol |
| Exact Mass | 657.48 |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;(Z)-4-oxo-4-[[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl]oxy]but-2-enoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)/C=C\C(=O)O)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2.[H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C33H52O5.C4H11N5/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-20-33(8)21-19-28-27(7)31(25(5)26(6)32(28)38-33)37-30(36)18-17-29(34)35;1-9(2)4(7)8-3(5)6/h17-18,22-24H,9-16,19-21H2,1-8H3,(H,34,35);1-2H3,(H5,5,6,7,8)/b18-17-; |
| InChIKey | QXROTZWBMCYUBR-YBFBCAGJSA-N |
| XLogP | 7.44 |
| TPSA | 164.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.94 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|