C39H58O10 — CID 54684385
4-O-[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] 1-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] (Z)-but-2-enedioate (PubChem CID 54684385) has the molecular formula C39H58O10 and a molecular weight of 686.88 g/mol. Its IUPAC name is 4-O-[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] 1-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] (Z)-but-2-enedioate.
| Compound Name | 4-O-[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] 1-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 54684385 |
| Molecular Formula | C39H58O10 |
| Molecular Weight | 686.88 g/mol |
| Exact Mass | 686.40 |
| IUPAC Name | 4-O-[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] 1-O-[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] (Z)-but-2-enedioate |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)/C=C\C(=O)OC1=C(O)C(C(O)CO)OC1=O)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C39H58O10/c1-23(2)12-9-13-24(3)14-10-15-25(4)16-11-20-39(8)21-19-29-28(7)34(26(5)27(6)35(29)49-39)46-31(42)17-18-32(43)47-37-33(44)36(30(41)22-40)48-38(37)45/h17-18,23-25,30,36,40-41,44H,9-16,19-22H2,1-8H3/b18-17- |
| InChIKey | XDDAGVUFLQKVEA-ZCXUNETKSA-N |
| XLogP | 7.19 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.88 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|