C11H7BrF3NO — CID 102941206
2-bromo-8-(2,2,2-trifluoroethoxy)quinoline (PubChem CID 102941206) has the molecular formula C11H7BrF3NO and a molecular weight of 306.08 g/mol. Its IUPAC name is 2-bromo-8-(2,2,2-trifluoroethoxy)quinoline.
| Compound Name | 2-bromo-8-(2,2,2-trifluoroethoxy)quinoline |
|---|---|
| PubChem CID | 102941206 |
| Molecular Formula | C11H7BrF3NO |
| Molecular Weight | 306.08 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 2-bromo-8-(2,2,2-trifluoroethoxy)quinoline |
| SMILES | FC(F)(F)COc1cccc2ccc(Br)nc12 |
| InChI | InChI=1S/C11H7BrF3NO/c12-9-5-4-7-2-1-3-8(10(7)16-9)17-6-11(13,14)15/h1-5H,6H2 |
| InChIKey | ZZRMELRTNZMSDT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.08 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|