C10H7F3N2O2 — CID 136677425
8-(2,2,2-trifluoroethoxy)-3H-quinazolin-4-one (PubChem CID 136677425) has the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. Its IUPAC name is 8-(2,2,2-trifluoroethoxy)-3H-quinazolin-4-one.
| Compound Name | 8-(2,2,2-trifluoroethoxy)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136677425 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 8-(2,2,2-trifluoroethoxy)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2c(OCC(F)(F)F)cccc12 |
| InChI | InChI=1S/C10H7F3N2O2/c11-10(12,13)4-17-7-3-1-2-6-8(7)14-5-15-9(6)16/h1-3,5H,4H2,(H,14,15,16) |
| InChIKey | XNDOSYDDDXSBCQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |