C11H14N2O2 — CID 103020647
2-(2-methoxypropan-2-yl)-1,3-benzoxazol-6-amine (PubChem CID 103020647) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(2-methoxypropan-2-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(2-methoxypropan-2-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 103020647 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(2-methoxypropan-2-yl)-1,3-benzoxazol-6-amine |
| SMILES | COC(C)(C)c1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C11H14N2O2/c1-11(2,14-3)10-13-8-5-4-7(12)6-9(8)15-10/h4-6H,12H2,1-3H3 |
| InChIKey | RPNFVUWYNDYHPC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|