C42H12F15GaN8O6 — CID 10307140
gallium;pyridine;2,3,17-trinitro-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-7,8-dihydrocorrin-21,23,24-triide (PubChem CID 10307140) has the molecular formula C42H12F15GaN8O6 and a molecular weight of 1079.30 g/mol. Its IUPAC name is gallium;pyridine;2,3,17-trinitro-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-7,8-dihydrocorrin-21,23,24-triide.
| Compound Name | gallium;pyridine;2,3,17-trinitro-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-7,8-dihydrocorrin-21,23,24-triide |
|---|---|
| PubChem CID | 10307140 |
| Molecular Formula | C42H12F15GaN8O6 |
| Molecular Weight | 1079.30 g/mol |
| Exact Mass | 1077.99 |
| IUPAC Name | gallium;pyridine;2,3,17-trinitro-5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-7,8-dihydrocorrin-21,23,24-triide |
| SMILES | O=[N+]([O-])c1cc2[n-]c1c(-c1c(F)c(F)c(F)c(F)c1F)c1ccc([n-]1)c(-c1c(F)c(F)c(F)c(F)c1F)c1nc(c(-c3c(F)c(F)c(F)c(F)c3F)c3[n-]c2c([N+](=O)[O-])c3[N+](=O)[O-])CC1.[Ga+3].c1ccncc1 |
| InChI | InChI=1S/C37H7F15N7O6.C5H5N.Ga/c38-18-15(19(39)25(45)30(50)24(18)44)12-6-1-3-8(53-6)13(16-20(40)26(46)31(51)27(47)21(16)41)34-11(57(60)61)5-10(55-34)33-36(58(62)63)37(59(64)65)35(56-33)14(9-4-2-7(12)54-9)17-22(42)28(48)32(52)29(49)23(17)43;1-2-4-6-5-3-1;/h1,3,5H,2,4H2;1-5H;/q-3;;+3/b12-6+,12-7+,13-8-,14-9-,33-10-,34-13+,35-14+;; |
| InChIKey | BZXSQJAWAMUSTI-KWUAEMRMSA-N |
| XLogP | 10.71 |
| TPSA | 197.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.30 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|