C44H15AlF15N5O2 — CID 74002989
aluminum;pyridine;5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-7,8-dihydrocorrin-21,22,24-triide-3,17-dicarbaldehyde (PubChem CID 74002989) has the molecular formula C44H15AlF15N5O2 and a molecular weight of 957.59 g/mol. Its IUPAC name is aluminum;pyridine;5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-7,8-dihydrocorrin-21,22,24-triide-3,17-dicarbaldehyde.
| Compound Name | aluminum;pyridine;5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-7,8-dihydrocorrin-21,22,24-triide-3,17-dicarbaldehyde |
|---|---|
| PubChem CID | 74002989 |
| Molecular Formula | C44H15AlF15N5O2 |
| Molecular Weight | 957.59 g/mol |
| Exact Mass | 957.08 |
| IUPAC Name | aluminum;pyridine;5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-7,8-dihydrocorrin-21,22,24-triide-3,17-dicarbaldehyde |
| SMILES | O=Cc1cc2[n-]c1c(-c1c(F)c(F)c(F)c(F)c1F)c1nc(c(-c3c(F)c(F)c(F)c(F)c3F)c3[n-]c(c(-c4c(F)c(F)c(F)c(F)c4F)c4[n-]c2cc4C=O)CC3)C=C1.[Al+3].c1ccncc1 |
| InChI | InChI=1S/C39H12F15N4O2.C5H5N.Al/c40-23-20(24(41)30(47)35(52)29(23)46)17-11-1-3-13(55-11)18(21-25(42)31(48)36(53)32(49)26(21)43)38-9(7-59)5-15(57-38)16-6-10(8-60)39(58-16)19(14-4-2-12(17)56-14)22-27(44)33(50)37(54)34(51)28(22)45;1-2-4-6-5-3-1;/h1,3,5-8H,2,4H2,(H2-,55,56,57,58,59,60);1-5H;/q-1;;+3/p-2 |
| InChIKey | DYSFAIFHRFBFLL-UHFFFAOYSA-L |
| XLogP | 10.50 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.59 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|