C15H28F2N2O3 — CID 103082598
tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclopentyl]methyl]carbamate (PubChem CID 103082598) has the molecular formula C15H28F2N2O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 103082598 |
| Molecular Formula | C15H28F2N2O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1NCCOCC(F)F |
| InChI | InChI=1S/C15H28F2N2O3/c1-15(2,3)22-14(20)19-9-11-5-4-6-12(11)18-7-8-21-10-13(16)17/h11-13,18H,4-10H2,1-3H3,(H,19,20) |
| InChIKey | UJYJAEPGXASFSR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|