C10H18F3NO2S — CID 103089361
ethyl 5-methylsulfanyl-2-(2,2,2-trifluoroethylamino)pentanoate (PubChem CID 103089361) has the molecular formula C10H18F3NO2S and a molecular weight of 273.32 g/mol. Its IUPAC name is ethyl 5-methylsulfanyl-2-(2,2,2-trifluoroethylamino)pentanoate.
| Compound Name | ethyl 5-methylsulfanyl-2-(2,2,2-trifluoroethylamino)pentanoate |
|---|---|
| PubChem CID | 103089361 |
| Molecular Formula | C10H18F3NO2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | ethyl 5-methylsulfanyl-2-(2,2,2-trifluoroethylamino)pentanoate |
| SMILES | CCOC(=O)C(CCCSC)NCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2S/c1-3-16-9(15)8(5-4-6-17-2)14-7-10(11,12)13/h8,14H,3-7H2,1-2H3 |
| InChIKey | OONBYLGETPHRRE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|