C16H17N3O3S2 — CID 10309143
2-cyclopentylsulfanyl-2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 10309143) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-cyclopentylsulfanyl-2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 10309143 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-cyclopentylsulfanyl-2-(4-nitrophenyl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Nc1nccs1)C(SC1CCCC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17N3O3S2/c20-15(18-16-17-9-10-23-16)14(24-13-3-1-2-4-13)11-5-7-12(8-6-11)19(21)22/h5-10,13-14H,1-4H2,(H,17,18,20) |
| InChIKey | LOWAOOYLJGBXRW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|