C17H13Cl2NO3 — CID 10315838
2-[3-[(3,4-dichlorophenyl)methyl]-2-oxo-3H-indol-1-yl]acetic acid (PubChem CID 10315838) has the molecular formula C17H13Cl2NO3 and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-[3-[(3,4-dichlorophenyl)methyl]-2-oxo-3H-indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(3,4-dichlorophenyl)methyl]-2-oxo-3H-indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 10315838 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[3-[(3,4-dichlorophenyl)methyl]-2-oxo-3H-indol-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(Cc2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C17H13Cl2NO3/c18-13-6-5-10(8-14(13)19)7-12-11-3-1-2-4-15(11)20(17(12)23)9-16(21)22/h1-6,8,12H,7,9H2,(H,21,22) |
| InChIKey | AJPROLABJSJVQL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |