C14H14N2O3S — CID 103182105
2-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]phenol (PubChem CID 103182105) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]phenol.
| Compound Name | 2-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]phenol |
|---|---|
| PubChem CID | 103182105 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]phenol |
| SMILES | Cc1cnc(CSc2ccccc2O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N2O3S/c1-9-7-15-11(10(2)14(9)16(18)19)8-20-13-6-4-3-5-12(13)17/h3-7,17H,8H2,1-2H3 |
| InChIKey | AKSFGBOUBWVPIE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|