C14H14FN3O2S — CID 103186022
3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]-5-fluoroaniline (PubChem CID 103186022) has the molecular formula C14H14FN3O2S and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]-5-fluoroaniline.
| Compound Name | 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 103186022 |
| Molecular Formula | C14H14FN3O2S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfanyl]-5-fluoroaniline |
| SMILES | Cc1cnc(CSc2cc(N)cc(F)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14FN3O2S/c1-8-6-17-13(9(2)14(8)18(19)20)7-21-12-4-10(15)3-11(16)5-12/h3-6H,7,16H2,1-2H3 |
| InChIKey | PAXFHANBTXKXNR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|