C12H16N2O6S — CID 103185968
3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfonyl]-2-methylpropanoic acid (PubChem CID 103185968) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfonyl]-2-methylpropanoic acid.
| Compound Name | 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfonyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 103185968 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-[(3,5-dimethyl-4-nitro-2-pyridinyl)methylsulfonyl]-2-methylpropanoic acid |
| SMILES | Cc1cnc(CS(=O)(=O)CC(C)C(=O)O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O6S/c1-7-4-13-10(9(3)11(7)14(17)18)6-21(19,20)5-8(2)12(15)16/h4,8H,5-6H2,1-3H3,(H,15,16) |
| InChIKey | OFNNHJZMBXTVTL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|