C10H19F3N2O2 — CID 103205454
N-(1-aminopentan-3-yl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103205454) has the molecular formula C10H19F3N2O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is N-(1-aminopentan-3-yl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(1-aminopentan-3-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103205454 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-(1-aminopentan-3-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CCC(CCN)NC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O2/c1-2-8(3-5-14)15-9(16)4-6-17-7-10(11,12)13/h8H,2-7,14H2,1H3,(H,15,16) |
| InChIKey | MBRHPKGSZHKUQD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|