C26H49FO4Si2 — CID 10323729
ethyl (2E)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(3-fluoropropyl)-2-methylidenecyclohexylidene]acetate (PubChem CID 10323729) has the molecular formula C26H49FO4Si2 and a molecular weight of 500.84 g/mol. Its IUPAC name is ethyl (2E)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(3-fluoropropyl)-2-methylidenecyclohexylidene]acetate.
| Compound Name | ethyl (2E)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(3-fluoropropyl)-2-methylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 10323729 |
| Molecular Formula | C26H49FO4Si2 |
| Molecular Weight | 500.84 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | ethyl (2E)-2-[(3R,4R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(3-fluoropropyl)-2-methylidenecyclohexylidene]acetate |
| SMILES | C=C1/C(=C/C(=O)OCC)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCCF)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H49FO4Si2/c1-13-29-23(28)18-20-17-22(30-32(9,10)25(3,4)5)21(15-14-16-27)24(19(20)2)31-33(11,12)26(6,7)8/h18,21-22,24H,2,13-17H2,1,3-12H3/b20-18+/t21-,22-,24+/m1/s1 |
| InChIKey | QGZAFSCLZWJHMP-DZYBSTILSA-N |
| XLogP | 7.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.84 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|