C27H51FO4Si2 — CID 10481610
ethyl (2Z)-2-[(3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(4-fluorobutyl)-2-methylidenecyclohexylidene]acetate (PubChem CID 10481610) has the molecular formula C27H51FO4Si2 and a molecular weight of 514.87 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(4-fluorobutyl)-2-methylidenecyclohexylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(4-fluorobutyl)-2-methylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 10481610 |
| Molecular Formula | C27H51FO4Si2 |
| Molecular Weight | 514.87 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | ethyl (2Z)-2-[(3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(4-fluorobutyl)-2-methylidenecyclohexylidene]acetate |
| SMILES | C=C1/C(=C\C(=O)OCC)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCCF)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H51FO4Si2/c1-13-30-24(29)19-21-18-23(31-33(9,10)26(3,4)5)22(16-14-15-17-28)25(20(21)2)32-34(11,12)27(6,7)8/h19,22-23,25H,2,13-18H2,1,3-12H3/b21-19-/t22-,23+,25+/m0/s1 |
| InChIKey | HTLJEJGELXAFCW-HOWMLNFFSA-N |
| XLogP | 7.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.87 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|