C34H43N7O5 — CID 10326658
(2S)-2-[[(2S)-2-(benzylamino)-3-phenylpropanoyl]amino]-N-[(3S)-6-(diaminomethylideneamino)-1-(4-nitrophenyl)-2-oxohexan-3-yl]-3-methylbutanamide (PubChem CID 10326658) has the molecular formula C34H43N7O5 and a molecular weight of 629.76 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(benzylamino)-3-phenylpropanoyl]amino]-N-[(3S)-6-(diaminomethylideneamino)-1-(4-nitrophenyl)-2-oxohexan-3-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-[[(2S)-2-(benzylamino)-3-phenylpropanoyl]amino]-N-[(3S)-6-(diaminomethylideneamino)-1-(4-nitrophenyl)-2-oxohexan-3-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 10326658 |
| Molecular Formula | C34H43N7O5 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | (2S)-2-[[(2S)-2-(benzylamino)-3-phenylpropanoyl]amino]-N-[(3S)-6-(diaminomethylideneamino)-1-(4-nitrophenyl)-2-oxohexan-3-yl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NCc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H43N7O5/c1-23(2)31(40-32(43)29(20-24-10-5-3-6-11-24)38-22-26-12-7-4-8-13-26)33(44)39-28(14-9-19-37-34(35)36)30(42)21-25-15-17-27(18-16-25)41(45)46/h3-8,10-13,15-18,23,28-29,31,38H,9,14,19-22H2,1-2H3,(H,39,44)(H,40,43)(H4,35,36,37)/t28-,29-,31-/m0/s1 |
| InChIKey | YBDCSUFJCRKEFG-QMOZSOIISA-N |
| XLogP | 2.79 |
| TPSA | 194.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|