C9H10F6N4O — CID 103312898
[3,3,3-trifluoro-1-(3-methoxypyrazin-2-yl)-2-(trifluoromethyl)propyl]hydrazine (PubChem CID 103312898) has the molecular formula C9H10F6N4O and a molecular weight of 304.19 g/mol. Its IUPAC name is [3,3,3-trifluoro-1-(3-methoxypyrazin-2-yl)-2-(trifluoromethyl)propyl]hydrazine.
| Compound Name | [3,3,3-trifluoro-1-(3-methoxypyrazin-2-yl)-2-(trifluoromethyl)propyl]hydrazine |
|---|---|
| PubChem CID | 103312898 |
| Molecular Formula | C9H10F6N4O |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [3,3,3-trifluoro-1-(3-methoxypyrazin-2-yl)-2-(trifluoromethyl)propyl]hydrazine |
| SMILES | COc1nccnc1C(NN)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10F6N4O/c1-20-7-5(17-2-3-18-7)4(19-16)6(8(10,11)12)9(13,14)15/h2-4,6,19H,16H2,1H3 |
| InChIKey | LDXUANMEWFLDMU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|