C13H14Cl2OS2 — CID 103344865
(2,5-dichlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanone (PubChem CID 103344865) has the molecular formula C13H14Cl2OS2 and a molecular weight of 321.29 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanone.
| Compound Name | (2,5-dichlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 103344865 |
| Molecular Formula | C13H14Cl2OS2 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | (2,5-dichlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanone |
| SMILES | CC1SCC(C(=O)c2cc(Cl)ccc2Cl)SC1C |
| InChI | InChI=1S/C13H14Cl2OS2/c1-7-8(2)18-12(6-17-7)13(16)10-5-9(14)3-4-11(10)15/h3-5,7-8,12H,6H2,1-2H3 |
| InChIKey | AYRYCJZIXGXGOZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |