C15H19NO5 — CID 10334570
(3S,4R,4aS,5R)-3,4-dihydroxy-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one (PubChem CID 10334570) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is (3S,4R,4aS,5R)-3,4-dihydroxy-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one.
| Compound Name | (3S,4R,4aS,5R)-3,4-dihydroxy-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one |
|---|---|
| PubChem CID | 10334570 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (3S,4R,4aS,5R)-3,4-dihydroxy-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one |
| SMILES | O=C1CC[C@@H](OCc2ccccc2)[C@@H]2[C@@H](O)[C@@H](O)CON12 |
| InChI | InChI=1S/C15H19NO5/c17-11-9-21-16-13(18)7-6-12(14(16)15(11)19)20-8-10-4-2-1-3-5-10/h1-5,11-12,14-15,17,19H,6-9H2/t11-,12+,14+,15-/m0/s1 |
| InChIKey | ITQSZGMHSOKAPF-MXYBEHONSA-N |
| XLogP | 0.23 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |