C19H27NO6 — CID 134905302
(2S,5S,7R)-7-hydroxy-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one (PubChem CID 134905302) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2S,5S,7R)-7-hydroxy-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one.
| Compound Name | (2S,5S,7R)-7-hydroxy-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one |
|---|---|
| PubChem CID | 134905302 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (2S,5S,7R)-7-hydroxy-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one |
| SMILES | COCOCC[C@@H]1CCC2[C@@H](OCc3ccccc3)C[C@@H](O)C(=O)N2O1 |
| InChI | InChI=1S/C19H27NO6/c1-23-13-24-10-9-15-7-8-16-18(11-17(21)19(22)20(16)26-15)25-12-14-5-3-2-4-6-14/h2-6,15-18,21H,7-13H2,1H3/t15-,16?,17+,18-/m0/s1 |
| InChIKey | XWPKTAKKMQKTTR-WOPUZOFWSA-N |
| XLogP | 1.64 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|