C16H16BrNS — CID 103351167
3-bromo-5-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)aniline (PubChem CID 103351167) has the molecular formula C16H16BrNS and a molecular weight of 334.28 g/mol. Its IUPAC name is 3-bromo-5-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)aniline.
| Compound Name | 3-bromo-5-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)aniline |
|---|---|
| PubChem CID | 103351167 |
| Molecular Formula | C16H16BrNS |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 3-bromo-5-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)aniline |
| SMILES | Nc1cc(Br)cc(CSc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C16H16BrNS/c17-14-6-11(7-15(18)9-14)10-19-16-5-4-12-2-1-3-13(12)8-16/h4-9H,1-3,10,18H2 |
| InChIKey | SQFZFUBTLWPDQD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|