C10H18F3NOS — CID 103369167
2-(3,3-dimethylbutoxymethyl)-3,3,3-trifluoropropanethioamide (PubChem CID 103369167) has the molecular formula C10H18F3NOS and a molecular weight of 257.32 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxymethyl)-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-(3,3-dimethylbutoxymethyl)-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103369167 |
| Molecular Formula | C10H18F3NOS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-(3,3-dimethylbutoxymethyl)-3,3,3-trifluoropropanethioamide |
| SMILES | CC(C)(C)CCOCC(C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NOS/c1-9(2,3)4-5-15-6-7(8(14)16)10(11,12)13/h7H,4-6H2,1-3H3,(H2,14,16) |
| InChIKey | BSTNPKBZFMYFQG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|