C12H13F3O5 — CID 103372216
2-[(2,6-dimethoxyphenoxy)methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 103372216) has the molecular formula C12H13F3O5 and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenoxy)methyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[(2,6-dimethoxyphenoxy)methyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 103372216 |
| Molecular Formula | C12H13F3O5 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[(2,6-dimethoxyphenoxy)methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | COc1cccc(OC)c1OCC(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O5/c1-18-8-4-3-5-9(19-2)10(8)20-6-7(11(16)17)12(13,14)15/h3-5,7H,6H2,1-2H3,(H,16,17) |
| InChIKey | BFHJHQNDXMRYFO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |