C11H19ClN2S — CID 103401521
N'-[(3-chloro-4-methylthiophen-2-yl)methyl]-N-propylethane-1,2-diamine (PubChem CID 103401521) has the molecular formula C11H19ClN2S and a molecular weight of 246.81 g/mol. Its IUPAC name is N'-[(3-chloro-4-methylthiophen-2-yl)methyl]-N-propylethane-1,2-diamine.
| Compound Name | N'-[(3-chloro-4-methylthiophen-2-yl)methyl]-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 103401521 |
| Molecular Formula | C11H19ClN2S |
| Molecular Weight | 246.81 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N'-[(3-chloro-4-methylthiophen-2-yl)methyl]-N-propylethane-1,2-diamine |
| SMILES | CCCNCCNCc1scc(C)c1Cl |
| InChI | InChI=1S/C11H19ClN2S/c1-3-4-13-5-6-14-7-10-11(12)9(2)8-15-10/h8,13-14H,3-7H2,1-2H3 |
| InChIKey | OWASOFFQZONDIA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.81 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|