C13H23ClN2S — CID 103401587
N'-tert-butyl-N-[(3-chloro-4-methylthiophen-2-yl)methyl]propane-1,3-diamine (PubChem CID 103401587) has the molecular formula C13H23ClN2S and a molecular weight of 274.86 g/mol. Its IUPAC name is N'-tert-butyl-N-[(3-chloro-4-methylthiophen-2-yl)methyl]propane-1,3-diamine.
| Compound Name | N'-tert-butyl-N-[(3-chloro-4-methylthiophen-2-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 103401587 |
| Molecular Formula | C13H23ClN2S |
| Molecular Weight | 274.86 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N'-tert-butyl-N-[(3-chloro-4-methylthiophen-2-yl)methyl]propane-1,3-diamine |
| SMILES | Cc1csc(CNCCCNC(C)(C)C)c1Cl |
| InChI | InChI=1S/C13H23ClN2S/c1-10-9-17-11(12(10)14)8-15-6-5-7-16-13(2,3)4/h9,15-16H,5-8H2,1-4H3 |
| InChIKey | WDDJUKQLOPNRIA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.86 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|