C12H21ClN2S — CID 103401528
N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 103401528) has the molecular formula C12H21ClN2S and a molecular weight of 260.83 g/mol. Its IUPAC name is N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 103401528 |
| Molecular Formula | C12H21ClN2S |
| Molecular Weight | 260.83 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[(3-chloro-4-methylthiophen-2-yl)methyl]-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | Cc1csc(CNCCNCC(C)C)c1Cl |
| InChI | InChI=1S/C12H21ClN2S/c1-9(2)6-14-4-5-15-7-11-12(13)10(3)8-16-11/h8-9,14-15H,4-7H2,1-3H3 |
| InChIKey | FRCBPAZBJVIESF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.83 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|