C9H14ClNOS — CID 103401538
2-[(3-chloro-4-methylthiophen-2-yl)methylamino]propan-1-ol (PubChem CID 103401538) has the molecular formula C9H14ClNOS and a molecular weight of 219.74 g/mol. Its IUPAC name is 2-[(3-chloro-4-methylthiophen-2-yl)methylamino]propan-1-ol.
| Compound Name | 2-[(3-chloro-4-methylthiophen-2-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 103401538 |
| Molecular Formula | C9H14ClNOS |
| Molecular Weight | 219.74 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-[(3-chloro-4-methylthiophen-2-yl)methylamino]propan-1-ol |
| SMILES | Cc1csc(CNC(C)CO)c1Cl |
| InChI | InChI=1S/C9H14ClNOS/c1-6-5-13-8(9(6)10)3-11-7(2)4-12/h5,7,11-12H,3-4H2,1-2H3 |
| InChIKey | QXKOWYNEBPLRQC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |