C20H21NO5S — CID 10340168
methyl 3-[1-(benzenesulfonyl)pyrrol-3-yl]-2-(2-methylidenecyclopentyl)-3-oxopropanoate (PubChem CID 10340168) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is methyl 3-[1-(benzenesulfonyl)pyrrol-3-yl]-2-(2-methylidenecyclopentyl)-3-oxopropanoate.
| Compound Name | methyl 3-[1-(benzenesulfonyl)pyrrol-3-yl]-2-(2-methylidenecyclopentyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 10340168 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | methyl 3-[1-(benzenesulfonyl)pyrrol-3-yl]-2-(2-methylidenecyclopentyl)-3-oxopropanoate |
| SMILES | C=C1CCCC1C(C(=O)OC)C(=O)c1ccn(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H21NO5S/c1-14-7-6-10-17(14)18(20(23)26-2)19(22)15-11-12-21(13-15)27(24,25)16-8-4-3-5-9-16/h3-5,8-9,11-13,17-18H,1,6-7,10H2,2H3 |
| InChIKey | YQFFSMTWJZNWHZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|