C10H8Br2ClN3O — CID 103417220
3-(chloromethyl)-4-(2,4-dibromo-5-methoxyphenyl)-1,2,4-triazole (PubChem CID 103417220) has the molecular formula C10H8Br2ClN3O and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(2,4-dibromo-5-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-(2,4-dibromo-5-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 103417220 |
| Molecular Formula | C10H8Br2ClN3O |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 378.87 |
| IUPAC Name | 3-(chloromethyl)-4-(2,4-dibromo-5-methoxyphenyl)-1,2,4-triazole |
| SMILES | COc1cc(-n2cnnc2CCl)c(Br)cc1Br |
| InChI | InChI=1S/C10H8Br2ClN3O/c1-17-9-3-8(6(11)2-7(9)12)16-5-14-15-10(16)4-13/h2-3,5H,4H2,1H3 |
| InChIKey | VXBDEYWYEJWGPV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|