C15H13BrCl2N2S — CID 103428067
N-[(4-bromothiophen-2-yl)methyl]-2-(4,6-dichloroindol-1-yl)ethanamine (PubChem CID 103428067) has the molecular formula C15H13BrCl2N2S and a molecular weight of 404.16 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(4,6-dichloroindol-1-yl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(4,6-dichloroindol-1-yl)ethanamine |
|---|---|
| PubChem CID | 103428067 |
| Molecular Formula | C15H13BrCl2N2S |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(4,6-dichloroindol-1-yl)ethanamine |
| SMILES | Clc1cc(Cl)c2ccn(CCNCc3cc(Br)cs3)c2c1 |
| InChI | InChI=1S/C15H13BrCl2N2S/c16-10-5-12(21-9-10)8-19-2-4-20-3-1-13-14(18)6-11(17)7-15(13)20/h1,3,5-7,9,19H,2,4,8H2 |
| InChIKey | PUQRYASEIMVXCW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|