C10H14F4O2 — CID 103474003
1-(2,2,3,3-tetrafluoropropoxy)hept-6-yn-2-ol (PubChem CID 103474003) has the molecular formula C10H14F4O2 and a molecular weight of 242.21 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropoxy)hept-6-yn-2-ol.
| Compound Name | 1-(2,2,3,3-tetrafluoropropoxy)hept-6-yn-2-ol |
|---|---|
| PubChem CID | 103474003 |
| Molecular Formula | C10H14F4O2 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropoxy)hept-6-yn-2-ol |
| SMILES | C#CCCCC(O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H14F4O2/c1-2-3-4-5-8(15)6-16-7-10(13,14)9(11)12/h1,8-9,15H,3-7H2 |
| InChIKey | LTDBJLWOHXHZDI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|