C9H18F4N2O3S — CID 103477523
[5-methylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-yl]hydrazine (PubChem CID 103477523) has the molecular formula C9H18F4N2O3S and a molecular weight of 310.31 g/mol. Its IUPAC name is [5-methylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-yl]hydrazine.
| Compound Name | [5-methylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477523 |
| Molecular Formula | C9H18F4N2O3S |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [5-methylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-yl]hydrazine |
| SMILES | CS(=O)(=O)CCCC(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C9H18F4N2O3S/c1-19(16,17)4-2-3-7(15-14)5-18-6-9(12,13)8(10)11/h7-8,15H,2-6,14H2,1H3 |
| InChIKey | BCTPUGAUMGLBLX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|