C13H26N2O3S — CID 103521276
N-[1-(3,3-dimethylbutylsulfonyl)-3-ethylpiperidin-4-ylidene]hydroxylamine (PubChem CID 103521276) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is N-[1-(3,3-dimethylbutylsulfonyl)-3-ethylpiperidin-4-ylidene]hydroxylamine.
| Compound Name | N-[1-(3,3-dimethylbutylsulfonyl)-3-ethylpiperidin-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 103521276 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-[1-(3,3-dimethylbutylsulfonyl)-3-ethylpiperidin-4-ylidene]hydroxylamine |
| SMILES | CCC1CN(S(=O)(=O)CCC(C)(C)C)CCC1=NO |
| InChI | InChI=1S/C13H26N2O3S/c1-5-11-10-15(8-6-12(11)14-16)19(17,18)9-7-13(2,3)4/h11,16H,5-10H2,1-4H3 |
| InChIKey | CVQYHPBLYDYHGI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|