C14H22O2 — CID 10353515
(3aS,4S,6aS)-6a-hex-5-enyl-4-hydroxy-2,3,3a,4,5,6-hexahydropentalen-1-one (PubChem CID 10353515) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3aS,4S,6aS)-6a-hex-5-enyl-4-hydroxy-2,3,3a,4,5,6-hexahydropentalen-1-one.
| Compound Name | (3aS,4S,6aS)-6a-hex-5-enyl-4-hydroxy-2,3,3a,4,5,6-hexahydropentalen-1-one |
|---|---|
| PubChem CID | 10353515 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3aS,4S,6aS)-6a-hex-5-enyl-4-hydroxy-2,3,3a,4,5,6-hexahydropentalen-1-one |
| SMILES | C=CCCCC[C@]12CC[C@H](O)[C@H]1CCC2=O |
| InChI | InChI=1S/C14H22O2/c1-2-3-4-5-9-14-10-8-12(15)11(14)6-7-13(14)16/h2,11-12,15H,1,3-10H2/t11-,12+,14+/m1/s1 |
| InChIKey | UNWGVIDEDRGJBH-DYEKYZERSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|