C6H7BrClFO — CID 10353779
(1S,5S,6S)-1-bromo-5-chloro-5-fluoro-7-oxabicyclo[4.1.0]heptane (PubChem CID 10353779) has the molecular formula C6H7BrClFO and a molecular weight of 229.48 g/mol. Its IUPAC name is (1S,5S,6S)-1-bromo-5-chloro-5-fluoro-7-oxabicyclo[4.1.0]heptane.
| Compound Name | (1S,5S,6S)-1-bromo-5-chloro-5-fluoro-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 10353779 |
| Molecular Formula | C6H7BrClFO |
| Molecular Weight | 229.48 g/mol |
| Exact Mass | 227.94 |
| IUPAC Name | (1S,5S,6S)-1-bromo-5-chloro-5-fluoro-7-oxabicyclo[4.1.0]heptane |
| SMILES | F[C@]1(Cl)CCC[C@@]2(Br)O[C@@H]12 |
| InChI | InChI=1S/C6H7BrClFO/c7-5-2-1-3-6(8,9)4(5)10-5/h4H,1-3H2/t4-,5-,6-/m1/s1 |
| InChIKey | VQCUFRFRCYFTNG-HSUXUTPPSA-N |
| XLogP | 2.56 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|