C6H7F3O — CID 148803960
(1R)-1,5,5-trifluoro-7-oxabicyclo[4.1.0]heptane (PubChem CID 148803960) has the molecular formula C6H7F3O and a molecular weight of 152.11 g/mol. Its IUPAC name is (1R)-1,5,5-trifluoro-7-oxabicyclo[4.1.0]heptane.
| Compound Name | (1R)-1,5,5-trifluoro-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 148803960 |
| Molecular Formula | C6H7F3O |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | (1R)-1,5,5-trifluoro-7-oxabicyclo[4.1.0]heptane |
| SMILES | FC1(F)CCC[C@]2(F)OC12 |
| InChI | InChI=1S/C6H7F3O/c7-5(8)2-1-3-6(9)4(5)10-6/h4H,1-3H2/t4?,6-/m0/s1 |
| InChIKey | OOOWSTRCAFOXJA-RZKHNPSRSA-N |
| XLogP | 1.87 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|