C16H24O2 — CID 10354665
(5Z)-4-methoxy-4-methyl-5-(2-methyloct-1-en-4-ylidene)cyclopent-2-en-1-one (PubChem CID 10354665) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (5Z)-4-methoxy-4-methyl-5-(2-methyloct-1-en-4-ylidene)cyclopent-2-en-1-one.
| Compound Name | (5Z)-4-methoxy-4-methyl-5-(2-methyloct-1-en-4-ylidene)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10354665 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (5Z)-4-methoxy-4-methyl-5-(2-methyloct-1-en-4-ylidene)cyclopent-2-en-1-one |
| SMILES | C=C(C)C/C(CCCC)=C1\C(=O)C=CC1(C)OC |
| InChI | InChI=1S/C16H24O2/c1-6-7-8-13(11-12(2)3)15-14(17)9-10-16(15,4)18-5/h9-10H,2,6-8,11H2,1,3-5H3/b15-13+ |
| InChIKey | HYXJHEBMXQQPGB-FYWRMAATSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|