C10H20O5S — CID 103547491
1-(1,3-dioxolan-2-yl)-5-ethylsulfonylpentan-2-ol (PubChem CID 103547491) has the molecular formula C10H20O5S and a molecular weight of 252.33 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-5-ethylsulfonylpentan-2-ol.
| Compound Name | 1-(1,3-dioxolan-2-yl)-5-ethylsulfonylpentan-2-ol |
|---|---|
| PubChem CID | 103547491 |
| Molecular Formula | C10H20O5S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-5-ethylsulfonylpentan-2-ol |
| SMILES | CCS(=O)(=O)CCCC(O)CC1OCCO1 |
| InChI | InChI=1S/C10H20O5S/c1-2-16(12,13)7-3-4-9(11)8-10-14-5-6-15-10/h9-11H,2-8H2,1H3 |
| InChIKey | FPSUKGOHPQJTKO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |