C11H12NS2+ — CID 10357962
5-methyl-4-methylsulfanyl-3-phenyl-1,3-thiazol-3-ium (PubChem CID 10357962) has the molecular formula C11H12NS2+ and a molecular weight of 222.36 g/mol. Its IUPAC name is 5-methyl-4-methylsulfanyl-3-phenyl-1,3-thiazol-3-ium.
| Compound Name | 5-methyl-4-methylsulfanyl-3-phenyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 10357962 |
| Molecular Formula | C11H12NS2+ |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 5-methyl-4-methylsulfanyl-3-phenyl-1,3-thiazol-3-ium |
| SMILES | CSc1c(C)sc[n+]1-c1ccccc1 |
| InChI | InChI=1S/C11H12NS2/c1-9-11(13-2)12(8-14-9)10-6-4-3-5-7-10/h3-8H,1-2H3/q+1 |
| InChIKey | QYSCIMJZJVZIPE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|