C12H13INS+ — CID 71294850
3-(2-iodo-6-methylphenyl)-4,5-dimethyl-1,3-thiazol-3-ium (PubChem CID 71294850) has the molecular formula C12H13INS+ and a molecular weight of 330.21 g/mol. Its IUPAC name is 3-(2-iodo-6-methylphenyl)-4,5-dimethyl-1,3-thiazol-3-ium.
| Compound Name | 3-(2-iodo-6-methylphenyl)-4,5-dimethyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 71294850 |
| Molecular Formula | C12H13INS+ |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 3-(2-iodo-6-methylphenyl)-4,5-dimethyl-1,3-thiazol-3-ium |
| SMILES | Cc1cccc(I)c1-[n+]1csc(C)c1C |
| InChI | InChI=1S/C12H13INS/c1-8-5-4-6-11(13)12(8)14-7-15-10(3)9(14)2/h4-7H,1-3H3/q+1 |
| InChIKey | ZTIUAPFGAWOAKY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|